C14H10FIN2O — CID 141024531
7-fluoro-N-(4-iodo-2-methylphenyl)-1,3-benzoxazol-6-amine (PubChem CID 141024531) has the molecular formula C14H10FIN2O and a molecular weight of 368.15 g/mol. Its IUPAC name is 7-fluoro-N-(4-iodo-2-methylphenyl)-1,3-benzoxazol-6-amine.
| Compound Name | 7-fluoro-N-(4-iodo-2-methylphenyl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 141024531 |
| Molecular Formula | C14H10FIN2O |
| Molecular Weight | 368.15 g/mol |
| Exact Mass | 367.98 |
| IUPAC Name | 7-fluoro-N-(4-iodo-2-methylphenyl)-1,3-benzoxazol-6-amine |
| SMILES | Cc1cc(I)ccc1Nc1ccc2ncoc2c1F |
| InChI | InChI=1S/C14H10FIN2O/c1-8-6-9(16)2-3-10(8)18-11-4-5-12-14(13(11)15)19-7-17-12/h2-7,18H,1H3 |
| InChIKey | OZKZKFVMJSGMSV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.15 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|