C16H12FIN2O3 — CID 174451373
[7-fluoro-6-(4-iodo-2-methylanilino)-1,3-benzoxazol-5-yl]methyl formate (PubChem CID 174451373) has the molecular formula C16H12FIN2O3 and a molecular weight of 426.19 g/mol. Its IUPAC name is [7-fluoro-6-(4-iodo-2-methylanilino)-1,3-benzoxazol-5-yl]methyl formate.
| Compound Name | [7-fluoro-6-(4-iodo-2-methylanilino)-1,3-benzoxazol-5-yl]methyl formate |
|---|---|
| PubChem CID | 174451373 |
| Molecular Formula | C16H12FIN2O3 |
| Molecular Weight | 426.19 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | [7-fluoro-6-(4-iodo-2-methylanilino)-1,3-benzoxazol-5-yl]methyl formate |
| SMILES | Cc1cc(I)ccc1Nc1c(COC=O)cc2ncoc2c1F |
| InChI | InChI=1S/C16H12FIN2O3/c1-9-4-11(18)2-3-12(9)20-15-10(6-22-8-21)5-13-16(14(15)17)23-7-19-13/h2-5,7-8,20H,6H2,1H3 |
| InChIKey | DRSSPGSWOJXPLW-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|