C11H23NO10 — CID 141024747
(3S,4R,5R,6R)-3-(dimethoxyamino)-6-(hydroxymethyl)-2,3,4-trimethoxyoxane-2,4,5-triol (PubChem CID 141024747) has the molecular formula C11H23NO10 and a molecular weight of 329.30 g/mol. Its IUPAC name is (3S,4R,5R,6R)-3-(dimethoxyamino)-6-(hydroxymethyl)-2,3,4-trimethoxyoxane-2,4,5-triol.
| Compound Name | (3S,4R,5R,6R)-3-(dimethoxyamino)-6-(hydroxymethyl)-2,3,4-trimethoxyoxane-2,4,5-triol |
|---|---|
| PubChem CID | 141024747 |
| Molecular Formula | C11H23NO10 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (3S,4R,5R,6R)-3-(dimethoxyamino)-6-(hydroxymethyl)-2,3,4-trimethoxyoxane-2,4,5-triol |
| SMILES | CON(OC)[C@@]1(OC)C(O)(OC)O[C@H](CO)[C@@H](O)[C@@]1(O)OC |
| InChI | InChI=1S/C11H23NO10/c1-17-9(15)8(14)7(6-13)22-11(16,19-3)10(9,18-2)12(20-4)21-5/h7-8,13-16H,6H2,1-5H3/t7-,8-,9-,10+,11?/m1/s1 |
| InChIKey | DJQSEVMSYQWIMK-UZJMVKBUSA-N |
| XLogP | -2.87 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|