C9H15N5O2 — CID 141031487
2-(2,4-diamino-6-methyl-2H-1,3,5-triazin-1-yl)ethyl prop-2-enoate (PubChem CID 141031487) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(2,4-diamino-6-methyl-2H-1,3,5-triazin-1-yl)ethyl prop-2-enoate.
| Compound Name | 2-(2,4-diamino-6-methyl-2H-1,3,5-triazin-1-yl)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141031487 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(2,4-diamino-6-methyl-2H-1,3,5-triazin-1-yl)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1C(C)=NC(N)=NC1N |
| InChI | InChI=1S/C9H15N5O2/c1-3-7(15)16-5-4-14-6(2)12-8(10)13-9(14)11/h3,9H,1,4-5,11H2,2H3,(H2,10,13) |
| InChIKey | YETBJDFWTUNESH-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 106.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|