C16H12N2O3 — CID 141035401
1-benzyl-2,3-diisocyanato-4-methoxybenzene (PubChem CID 141035401) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 1-benzyl-2,3-diisocyanato-4-methoxybenzene.
| Compound Name | 1-benzyl-2,3-diisocyanato-4-methoxybenzene |
|---|---|
| PubChem CID | 141035401 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-benzyl-2,3-diisocyanato-4-methoxybenzene |
| SMILES | COc1ccc(Cc2ccccc2)c(N=C=O)c1N=C=O |
| InChI | InChI=1S/C16H12N2O3/c1-21-14-8-7-13(9-12-5-3-2-4-6-12)15(17-10-19)16(14)18-11-20/h2-8H,9H2,1H3 |
| InChIKey | BRNIKDXGZJWDHU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|