C6H13NO3S — CID 141047771
1-(1,3-thiazolidin-2-yl)propane-1,2,3-triol (PubChem CID 141047771) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is 1-(1,3-thiazolidin-2-yl)propane-1,2,3-triol.
| Compound Name | 1-(1,3-thiazolidin-2-yl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 141047771 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 1-(1,3-thiazolidin-2-yl)propane-1,2,3-triol |
| SMILES | OCC(O)C(O)C1NCCS1 |
| InChI | InChI=1S/C6H13NO3S/c8-3-4(9)5(10)6-7-1-2-11-6/h4-10H,1-3H2 |
| InChIKey | OQTAYOGMHDUFKN-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |