C8H17NO5S — CID 7187937
(1S,2R,3R,4R)-1-[(2S)-1,3-thiazolidin-2-yl]pentane-1,2,3,4,5-pentol (PubChem CID 7187937) has the molecular formula C8H17NO5S and a molecular weight of 239.29 g/mol. Its IUPAC name is (1S,2R,3R,4R)-1-[(2S)-1,3-thiazolidin-2-yl]pentane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,3R,4R)-1-[(2S)-1,3-thiazolidin-2-yl]pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 7187937 |
| Molecular Formula | C8H17NO5S |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | (1S,2R,3R,4R)-1-[(2S)-1,3-thiazolidin-2-yl]pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H](O)[C@H](O)[C@H]1NCCS1 |
| InChI | InChI=1S/C8H17NO5S/c10-3-4(11)5(12)6(13)7(14)8-9-1-2-15-8/h4-14H,1-3H2/t4-,5-,6-,7+,8+/m1/s1 |
| InChIKey | RCHUVONGFCEQNK-YQXRAVKXSA-N |
| XLogP | -2.92 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | -2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |