C7H15NO4S — CID 10398173
(1S,2R,3R)-1-[(2R)-1,3-thiazolidin-2-yl]butane-1,2,3,4-tetrol (PubChem CID 10398173) has the molecular formula C7H15NO4S and a molecular weight of 209.27 g/mol. Its IUPAC name is (1S,2R,3R)-1-[(2R)-1,3-thiazolidin-2-yl]butane-1,2,3,4-tetrol.
| Compound Name | (1S,2R,3R)-1-[(2R)-1,3-thiazolidin-2-yl]butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 10398173 |
| Molecular Formula | C7H15NO4S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (1S,2R,3R)-1-[(2R)-1,3-thiazolidin-2-yl]butane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H]1NCCS1 |
| InChI | InChI=1S/C7H15NO4S/c9-3-4(10)5(11)6(12)7-8-1-2-13-7/h4-12H,1-3H2/t4-,5-,6+,7-/m1/s1 |
| InChIKey | AWVZVRNVQCAWAJ-MVIOUDGNSA-N |
| XLogP | -2.28 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |