C7H14N2O5S — CID 121494104
(1R,2S,3S)-1-(3-nitroso-1,3-thiazolidin-2-yl)butane-1,2,3,4-tetrol (PubChem CID 121494104) has the molecular formula C7H14N2O5S and a molecular weight of 238.26 g/mol. Its IUPAC name is (1R,2S,3S)-1-(3-nitroso-1,3-thiazolidin-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S)-1-(3-nitroso-1,3-thiazolidin-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 121494104 |
| Molecular Formula | C7H14N2O5S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | (1R,2S,3S)-1-(3-nitroso-1,3-thiazolidin-2-yl)butane-1,2,3,4-tetrol |
| SMILES | O=NN1CCSC1[C@H](O)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C7H14N2O5S/c10-3-4(11)5(12)6(13)7-9(8-14)1-2-15-7/h4-7,10-13H,1-3H2/t4-,5-,6+,7?/m0/s1 |
| InChIKey | CPLRXCSJNHIVBJ-VNEOENNNSA-N |
| XLogP | -1.88 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|