C9H15NO6S — CID 163725948
(3R,6S)-6-(1,2,3,4-tetrahydroxybutyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid (PubChem CID 163725948) has the molecular formula C9H15NO6S and a molecular weight of 265.29 g/mol. Its IUPAC name is (3R,6S)-6-(1,2,3,4-tetrahydroxybutyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid.
| Compound Name | (3R,6S)-6-(1,2,3,4-tetrahydroxybutyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid |
|---|---|
| PubChem CID | 163725948 |
| Molecular Formula | C9H15NO6S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | (3R,6S)-6-(1,2,3,4-tetrahydroxybutyl)-3,6-dihydro-2H-1,4-thiazine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSC(C(O)C(O)C(O)CO)C=N1 |
| InChI | InChI=1S/C9H15NO6S/c11-2-5(12)7(13)8(14)6-1-10-4(3-17-6)9(15)16/h1,4-8,11-14H,2-3H2,(H,15,16)/t4-,5?,6?,7?,8?/m0/s1 |
| InChIKey | KVOQEVHCVWKICS-DKBGPPMCSA-N |
| XLogP | -2.30 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |