C17H34N2O4S — CID 141050239
[4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methylsulfamic acid (PubChem CID 141050239) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is [4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methylsulfamic acid.
| Compound Name | [4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methylsulfamic acid |
|---|---|
| PubChem CID | 141050239 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | [4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methylsulfamic acid |
| SMILES | C=CCCNCCCCCCOC1CCC(CNS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C17H34N2O4S/c1-2-3-12-18-13-6-4-5-7-14-23-17-10-8-16(9-11-17)15-19-24(20,21)22/h2,16-19H,1,3-15H2,(H,20,21,22) |
| InChIKey | JMUVXTKFRXWMRH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|