C11H22O3S — CID 141053074
methyl 6-ethylsulfinyl-4,4-dimethylhexanoate (PubChem CID 141053074) has the molecular formula C11H22O3S and a molecular weight of 234.36 g/mol. Its IUPAC name is methyl 6-ethylsulfinyl-4,4-dimethylhexanoate.
| Compound Name | methyl 6-ethylsulfinyl-4,4-dimethylhexanoate |
|---|---|
| PubChem CID | 141053074 |
| Molecular Formula | C11H22O3S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | methyl 6-ethylsulfinyl-4,4-dimethylhexanoate |
| SMILES | CCS(=O)CCC(C)(C)CCC(=O)OC |
| InChI | InChI=1S/C11H22O3S/c1-5-15(13)9-8-11(2,3)7-6-10(12)14-4/h5-9H2,1-4H3 |
| InChIKey | GQJZCCUSZXODFG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |