C25H26N6O2 — CID 141056215
2-cyclopentyloxy-3-methoxy-N-(pyridin-3-ylmethyl)-N-[4-(2H-tetrazol-5-yl)phenyl]aniline (PubChem CID 141056215) has the molecular formula C25H26N6O2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-cyclopentyloxy-3-methoxy-N-(pyridin-3-ylmethyl)-N-[4-(2H-tetrazol-5-yl)phenyl]aniline.
| Compound Name | 2-cyclopentyloxy-3-methoxy-N-(pyridin-3-ylmethyl)-N-[4-(2H-tetrazol-5-yl)phenyl]aniline |
|---|---|
| PubChem CID | 141056215 |
| Molecular Formula | C25H26N6O2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-cyclopentyloxy-3-methoxy-N-(pyridin-3-ylmethyl)-N-[4-(2H-tetrazol-5-yl)phenyl]aniline |
| SMILES | COc1cccc(N(Cc2cccnc2)c2ccc(-c3nn[nH]n3)cc2)c1OC1CCCC1 |
| InChI | InChI=1S/C25H26N6O2/c1-32-23-10-4-9-22(24(23)33-21-7-2-3-8-21)31(17-18-6-5-15-26-16-18)20-13-11-19(12-14-20)25-27-29-30-28-25/h4-6,9-16,21H,2-3,7-8,17H2,1H3,(H,27,28,29,30) |
| InChIKey | ZVRNNSNOAOYBJL-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |