C25H29N3O4S — CID 141056205
N-[3-cyclopentyloxy-2-methoxy-4-[N-(pyridin-3-ylmethyl)anilino]phenyl]methanesulfonamide (PubChem CID 141056205) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[3-cyclopentyloxy-2-methoxy-4-[N-(pyridin-3-ylmethyl)anilino]phenyl]methanesulfonamide.
| Compound Name | N-[3-cyclopentyloxy-2-methoxy-4-[N-(pyridin-3-ylmethyl)anilino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 141056205 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[3-cyclopentyloxy-2-methoxy-4-[N-(pyridin-3-ylmethyl)anilino]phenyl]methanesulfonamide |
| SMILES | COc1c(NS(C)(=O)=O)ccc(N(Cc2cccnc2)c2ccccc2)c1OC1CCCC1 |
| InChI | InChI=1S/C25H29N3O4S/c1-31-24-22(27-33(2,29)30)14-15-23(25(24)32-21-12-6-7-13-21)28(20-10-4-3-5-11-20)18-19-9-8-16-26-17-19/h3-5,8-11,14-17,21,27H,6-7,12-13,18H2,1-2H3 |
| InChIKey | RHGBKRKKFUMJIQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |