C22H14F3N3O2 — CID 141074285
3-[3-(2-cyano-4-pyridinyl)phenyl]-3-oxo-N-[3-(trifluoromethyl)phenyl]propanamide (PubChem CID 141074285) has the molecular formula C22H14F3N3O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is 3-[3-(2-cyano-4-pyridinyl)phenyl]-3-oxo-N-[3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-[3-(2-cyano-4-pyridinyl)phenyl]-3-oxo-N-[3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 141074285 |
| Molecular Formula | C22H14F3N3O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 3-[3-(2-cyano-4-pyridinyl)phenyl]-3-oxo-N-[3-(trifluoromethyl)phenyl]propanamide |
| SMILES | N#Cc1cc(-c2cccc(C(=O)CC(=O)Nc3cccc(C(F)(F)F)c3)c2)ccn1 |
| InChI | InChI=1S/C22H14F3N3O2/c23-22(24,25)17-5-2-6-18(11-17)28-21(30)12-20(29)16-4-1-3-14(9-16)15-7-8-27-19(10-15)13-26/h1-11H,12H2,(H,28,30) |
| InChIKey | ULHNAEHHKUFIGE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|