C7H14O6S4 — CID 141080085
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-hydroxy-2-(tetrasulfanyl)acetate (PubChem CID 141080085) has the molecular formula C7H14O6S4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-hydroxy-2-(tetrasulfanyl)acetate.
| Compound Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-hydroxy-2-(tetrasulfanyl)acetate |
|---|---|
| PubChem CID | 141080085 |
| Molecular Formula | C7H14O6S4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 2-hydroxy-2-(tetrasulfanyl)acetate |
| SMILES | O=C(OCC(CO)(CO)CO)C(O)SSSS |
| InChI | InChI=1S/C7H14O6S4/c8-1-7(2-9,3-10)4-13-5(11)6(12)15-17-16-14/h6,8-10,12,14H,1-4H2 |
| InChIKey | WGFDGQWFDVGXKA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|