C12H21NO2 — CID 141085642
3-(2-methoxycyclohexa-1,3-dien-1-yl)oxy-N,N-dimethylpropan-1-amine (PubChem CID 141085642) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-(2-methoxycyclohexa-1,3-dien-1-yl)oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-methoxycyclohexa-1,3-dien-1-yl)oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 141085642 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-(2-methoxycyclohexa-1,3-dien-1-yl)oxy-N,N-dimethylpropan-1-amine |
| SMILES | COC1=C(OCCCN(C)C)CCC=C1 |
| InChI | InChI=1S/C12H21NO2/c1-13(2)9-6-10-15-12-8-5-4-7-11(12)14-3/h4,7H,5-6,8-10H2,1-3H3 |
| InChIKey | XFXNPPXOHSKFCO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|