C21H49N5 — CID 141087039
4-[butyl-(dipropylamino)amino]-1-N",1-N"-diethyl-1-N,1-N',1-N'-trimethylbutane-1,1,1-triamine (PubChem CID 141087039) has the molecular formula C21H49N5 and a molecular weight of 371.66 g/mol. Its IUPAC name is 4-[butyl-(dipropylamino)amino]-1-N",1-N"-diethyl-1-N,1-N',1-N'-trimethylbutane-1,1,1-triamine.
| Compound Name | 4-[butyl-(dipropylamino)amino]-1-N",1-N"-diethyl-1-N,1-N',1-N'-trimethylbutane-1,1,1-triamine |
|---|---|
| PubChem CID | 141087039 |
| Molecular Formula | C21H49N5 |
| Molecular Weight | 371.66 g/mol |
| Exact Mass | 371.40 |
| IUPAC Name | 4-[butyl-(dipropylamino)amino]-1-N",1-N"-diethyl-1-N,1-N',1-N'-trimethylbutane-1,1,1-triamine |
| SMILES | CCCCN(CCCC(NC)(N(C)C)N(CC)CC)N(CCC)CCC |
| InChI | InChI=1S/C21H49N5/c1-9-14-19-26(25(17-10-2)18-11-3)20-15-16-21(22-6,23(7)8)24(12-4)13-5/h22H,9-20H2,1-8H3 |
| InChIKey | KOQABJFPPYSMCV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.66 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|