C9H22N2 — CID 54254142
1,1,2-triethyl-2-propylhydrazine (PubChem CID 54254142) has the molecular formula C9H22N2 and a molecular weight of 158.29 g/mol. Its IUPAC name is 1,1,2-triethyl-2-propylhydrazine.
| Compound Name | 1,1,2-triethyl-2-propylhydrazine |
|---|---|
| PubChem CID | 54254142 |
| Molecular Formula | C9H22N2 |
| Molecular Weight | 158.29 g/mol |
| Exact Mass | 158.18 |
| IUPAC Name | 1,1,2-triethyl-2-propylhydrazine |
| SMILES | CCCN(CC)N(CC)CC |
| InChI | InChI=1S/C9H22N2/c1-5-9-11(8-4)10(6-2)7-3/h5-9H2,1-4H3 |
| InChIKey | QYVFSGGLUWOBCC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|