C11H22N2O2 — CID 141095306
2,2-dimethyl-3-pentylbutanediamide (PubChem CID 141095306) has the molecular formula C11H22N2O2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-pentylbutanediamide.
| Compound Name | 2,2-dimethyl-3-pentylbutanediamide |
|---|---|
| PubChem CID | 141095306 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,2-dimethyl-3-pentylbutanediamide |
| SMILES | CCCCCC(C(N)=O)C(C)(C)C(N)=O |
| InChI | InChI=1S/C11H22N2O2/c1-4-5-6-7-8(9(12)14)11(2,3)10(13)15/h8H,4-7H2,1-3H3,(H2,12,14)(H2,13,15) |
| InChIKey | NQTIRWDRUWRFLR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|