About 4-bromo-3-phenyl-1,2-dihydropyridazine
4-bromo-3-phenyl-1,2-dihydropyridazine (PubChem CID 141098548) has the molecular formula C10H9BrN2
and a molecular weight of 237.10 g/mol. Its IUPAC name is 4-bromo-3-phenyl-1,2-dihydropyridazine.
Molecular Properties
| Compound Name | 4-bromo-3-phenyl-1,2-dihydropyridazine |
| PubChem CID | 141098548 |
| Molecular Formula | C10H9BrN2 |
| Molecular Weight | 237.10 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 4-bromo-3-phenyl-1,2-dihydropyridazine |
| SMILES | BrC1=C(c2ccccc2)NNC=C1 |
| InChI | InChI=1S/C10H9BrN2/c11-9-6-7-12-13-10(9)8-4-2-1-3-5-8/h1-7,12-13H |
| InChIKey | AREUQULIDHPDAM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.10 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-3-phenyl-1,2-dihydropyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-phenyl-1,2-dihydropyridazine?
The IUPAC name of 4-bromo-3-phenyl-1,2-dihydropyridazine (CID 141098548) is 4-bromo-3-phenyl-1,2-dihydropyridazine.
What is the SMILES notation for 4-bromo-3-phenyl-1,2-dihydropyridazine?
The canonical SMILES for 4-bromo-3-phenyl-1,2-dihydropyridazine is BrC1=C(c2ccccc2)NNC=C1.
What is the InChIKey of 4-bromo-3-phenyl-1,2-dihydropyridazine?
The InChIKey is AREUQULIDHPDAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2/c11-9-6-7-12-13-10(9)8-4-2-1-3-5-8/h1-7,12-13H.
What are the key properties of 4-bromo-3-phenyl-1,2-dihydropyridazine?
4-bromo-3-phenyl-1,2-dihydropyridazine has a molecular weight of 237.10 g/mol, XLogP of 2.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-phenyl-1,2-dihydropyridazine is sourced from PubChem (CID 141098548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).