C14H13N3 — CID 163692721
4,5-diphenyl-2,3-dihydro-1H-triazole (PubChem CID 163692721) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4,5-diphenyl-2,3-dihydro-1H-triazole.
| Compound Name | 4,5-diphenyl-2,3-dihydro-1H-triazole |
|---|---|
| PubChem CID | 163692721 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4,5-diphenyl-2,3-dihydro-1H-triazole |
| SMILES | c1ccc(C2=C(c3ccccc3)NNN2)cc1 |
| InChI | InChI=1S/C14H13N3/c1-3-7-11(8-4-1)13-14(16-17-15-13)12-9-5-2-6-10-12/h1-10,15-17H |
| InChIKey | JUIFTGJJVJLLCG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|