C14H11ClN2 — CID 118601774
1-chloro-4-phenyl-2,3-dihydrophthalazine (PubChem CID 118601774) has the molecular formula C14H11ClN2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 1-chloro-4-phenyl-2,3-dihydrophthalazine.
| Compound Name | 1-chloro-4-phenyl-2,3-dihydrophthalazine |
|---|---|
| PubChem CID | 118601774 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 1-chloro-4-phenyl-2,3-dihydrophthalazine |
| SMILES | ClC1=c2ccccc2=C(c2ccccc2)NN1 |
| InChI | InChI=1S/C14H11ClN2/c15-14-12-9-5-4-8-11(12)13(16-17-14)10-6-2-1-3-7-10/h1-9,16-17H |
| InChIKey | GZPRFLTYQMXMHZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|