About ethane;trimethyl(phenyl)boranuide
ethane;trimethyl(phenyl)boranuide (PubChem CID 91180223) has the molecular formula C13H26B-
and a molecular weight of 193.16 g/mol. Its IUPAC name is ethane;trimethyl(phenyl)boranuide.
Molecular Properties
| Compound Name | ethane;trimethyl(phenyl)boranuide |
| PubChem CID | 91180223 |
| Molecular Formula | C13H26B- |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.21 |
| IUPAC Name | ethane;trimethyl(phenyl)boranuide |
| SMILES | CC.CC.C[B-](C)(C)c1ccccc1 |
| InChI | InChI=1S/C9H14B.2C2H6/c1-10(2,3)9-7-5-4-6-8-9;2*1-2/h4-8H,1-3H3;2*1-2H3/q-1;; |
| InChIKey | KTCZLDZHIZDKBL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethane;trimethyl(phenyl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;trimethyl(phenyl)boranuide?
The IUPAC name of ethane;trimethyl(phenyl)boranuide (CID 91180223) is ethane;trimethyl(phenyl)boranuide.
What is the SMILES notation for ethane;trimethyl(phenyl)boranuide?
The canonical SMILES for ethane;trimethyl(phenyl)boranuide is CC.CC.C[B-](C)(C)c1ccccc1.
What is the InChIKey of ethane;trimethyl(phenyl)boranuide?
The InChIKey is KTCZLDZHIZDKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14B.2C2H6/c1-10(2,3)9-7-5-4-6-8-9;2*1-2/h4-8H,1-3H3;2*1-2H3/q-1;;.
What are the key properties of ethane;trimethyl(phenyl)boranuide?
ethane;trimethyl(phenyl)boranuide has a molecular weight of 193.16 g/mol, XLogP of 4.28, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;trimethyl(phenyl)boranuide is sourced from PubChem (CID 91180223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).