C7H9NO3S2 — CID 141100060
(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methylsulfanylmethanethioic S-acid (PubChem CID 141100060) has the molecular formula C7H9NO3S2 and a molecular weight of 219.29 g/mol. Its IUPAC name is (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methylsulfanylmethanethioic S-acid.
| Compound Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methylsulfanylmethanethioic S-acid |
|---|---|
| PubChem CID | 141100060 |
| Molecular Formula | C7H9NO3S2 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.00 |
| IUPAC Name | (4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)methylsulfanylmethanethioic S-acid |
| SMILES | CC1(C)N=C(CSC(=O)S)OC1=O |
| InChI | InChI=1S/C7H9NO3S2/c1-7(2)5(9)11-4(8-7)3-13-6(10)12/h3H2,1-2H3,(H,10,12) |
| InChIKey | MYKSIHHDOUUOPL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|