C10H17N2O2+ — CID 10058539
[(E)-2-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)ethenyl]-trimethylazanium (PubChem CID 10058539) has the molecular formula C10H17N2O2+ and a molecular weight of 197.26 g/mol. Its IUPAC name is [(E)-2-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)ethenyl]-trimethylazanium.
| Compound Name | [(E)-2-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)ethenyl]-trimethylazanium |
|---|---|
| PubChem CID | 10058539 |
| Molecular Formula | C10H17N2O2+ |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | [(E)-2-(4,4-dimethyl-5-oxo-1,3-oxazol-2-yl)ethenyl]-trimethylazanium |
| SMILES | CC1(C)N=C(/C=C/[N+](C)(C)C)OC1=O |
| InChI | InChI=1S/C10H17N2O2/c1-10(2)9(13)14-8(11-10)6-7-12(3,4)5/h6-7H,1-5H3/q+1/b7-6+ |
| InChIKey | GHOBSYGIGORXKR-VOTSOKGWSA-N |
| XLogP | 0.94 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|