C11H20N2O2S2 — CID 142955339
2-[[(R)-diethylamino(sulfanyl)methyl]sulfanylmethyl]-4,4-dimethyl-1,3-oxazol-5-one (PubChem CID 142955339) has the molecular formula C11H20N2O2S2 and a molecular weight of 276.43 g/mol. Its IUPAC name is 2-[[(R)-diethylamino(sulfanyl)methyl]sulfanylmethyl]-4,4-dimethyl-1,3-oxazol-5-one.
| Compound Name | 2-[[(R)-diethylamino(sulfanyl)methyl]sulfanylmethyl]-4,4-dimethyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 142955339 |
| Molecular Formula | C11H20N2O2S2 |
| Molecular Weight | 276.43 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-[[(R)-diethylamino(sulfanyl)methyl]sulfanylmethyl]-4,4-dimethyl-1,3-oxazol-5-one |
| SMILES | CCN(CC)[C@H](S)SCC1=NC(C)(C)C(=O)O1 |
| InChI | InChI=1S/C11H20N2O2S2/c1-5-13(6-2)10(16)17-7-8-12-11(3,4)9(14)15-8/h10,16H,5-7H2,1-4H3/t10-/m1/s1 |
| InChIKey | LBONPUDFXDICLM-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|