C21H33AlN6O12 — CID 141105340
bis[[(2R)-2-acetyl-2,5-diamino-5-oxopentanoyl]oxy]alumanyl (2R)-2-acetyl-2,5-diamino-5-oxopentanoate (PubChem CID 141105340) has the molecular formula C21H33AlN6O12 and a molecular weight of 588.51 g/mol. Its IUPAC name is bis[[(2R)-2-acetyl-2,5-diamino-5-oxopentanoyl]oxy]alumanyl (2R)-2-acetyl-2,5-diamino-5-oxopentanoate.
| Compound Name | bis[[(2R)-2-acetyl-2,5-diamino-5-oxopentanoyl]oxy]alumanyl (2R)-2-acetyl-2,5-diamino-5-oxopentanoate |
|---|---|
| PubChem CID | 141105340 |
| Molecular Formula | C21H33AlN6O12 |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | bis[[(2R)-2-acetyl-2,5-diamino-5-oxopentanoyl]oxy]alumanyl (2R)-2-acetyl-2,5-diamino-5-oxopentanoate |
| SMILES | CC(=O)[C@](N)(CCC(N)=O)C(=O)O[Al](OC(=O)[C@@](N)(CCC(N)=O)C(C)=O)OC(=O)[C@@](N)(CCC(N)=O)C(C)=O |
| InChI | InChI=1S/3C7H12N2O4.Al/c3*1-4(10)7(9,6(12)13)3-2-5(8)11;/h3*2-3,9H2,1H3,(H2,8,11)(H,12,13);/q;;;+3/p-3/t3*7-;/m111./s1 |
| InChIKey | JEMIMNCMCFNJHZ-ZPJYHVBCSA-K |
| XLogP | -4.74 |
| TPSA | 337.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | -4.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|