C26H30N4O5 — CID 141116657
tert-butyl 2-(5-hydroxy-1H-indazol-3-yl)-5-(2-morpholin-4-ylethoxy)indole-1-carboxylate (PubChem CID 141116657) has the molecular formula C26H30N4O5 and a molecular weight of 478.55 g/mol. Its IUPAC name is tert-butyl 2-(5-hydroxy-1H-indazol-3-yl)-5-(2-morpholin-4-ylethoxy)indole-1-carboxylate.
| Compound Name | tert-butyl 2-(5-hydroxy-1H-indazol-3-yl)-5-(2-morpholin-4-ylethoxy)indole-1-carboxylate |
|---|---|
| PubChem CID | 141116657 |
| Molecular Formula | C26H30N4O5 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | tert-butyl 2-(5-hydroxy-1H-indazol-3-yl)-5-(2-morpholin-4-ylethoxy)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(-c2n[nH]c3ccc(O)cc23)cc2cc(OCCN3CCOCC3)ccc21 |
| InChI | InChI=1S/C26H30N4O5/c1-26(2,3)35-25(32)30-22-7-5-19(34-13-10-29-8-11-33-12-9-29)14-17(22)15-23(30)24-20-16-18(31)4-6-21(20)27-28-24/h4-7,14-16,31H,8-13H2,1-3H3,(H,27,28) |
| InChIKey | RXPSYHCKCDRONX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |