C28H29NO5 — CID 141118732
(2S,3S,4S,5R,6R)-6-(isocyanomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol (PubChem CID 141118732) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-6-(isocyanomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol.
| Compound Name | (2S,3S,4S,5R,6R)-6-(isocyanomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
|---|---|
| PubChem CID | 141118732 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-(isocyanomethyl)-3,4,5-tris(phenylmethoxy)oxan-2-ol |
| SMILES | [C-]#[N+]C[C@H]1O[C@H](O)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H29NO5/c1-29-17-24-25(31-18-21-11-5-2-6-12-21)26(32-19-22-13-7-3-8-14-22)27(28(30)34-24)33-20-23-15-9-4-10-16-23/h2-16,24-28,30H,17-20H2/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | RJKSYGKZDGFLPV-MASCHLQQSA-N |
| XLogP | 4.38 |
| TPSA | 61.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|