C20H27O13P — CID 141135002
2-hydroxyethyl 3-[bis(1-prop-2-enoyloxyethoxy)phosphoryloxy]-2-methylidene-3-prop-2-enoyloxybutanoate (PubChem CID 141135002) has the molecular formula C20H27O13P and a molecular weight of 506.40 g/mol. Its IUPAC name is 2-hydroxyethyl 3-[bis(1-prop-2-enoyloxyethoxy)phosphoryloxy]-2-methylidene-3-prop-2-enoyloxybutanoate.
| Compound Name | 2-hydroxyethyl 3-[bis(1-prop-2-enoyloxyethoxy)phosphoryloxy]-2-methylidene-3-prop-2-enoyloxybutanoate |
|---|---|
| PubChem CID | 141135002 |
| Molecular Formula | C20H27O13P |
| Molecular Weight | 506.40 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 2-hydroxyethyl 3-[bis(1-prop-2-enoyloxyethoxy)phosphoryloxy]-2-methylidene-3-prop-2-enoyloxybutanoate |
| SMILES | C=CC(=O)OC(C)OP(=O)(OC(C)OC(=O)C=C)OC(C)(OC(=O)C=C)C(=C)C(=O)OCCO |
| InChI | InChI=1S/C20H27O13P/c1-8-16(22)28-14(5)31-34(26,32-15(6)29-17(23)9-2)33-20(7,30-18(24)10-3)13(4)19(25)27-12-11-21/h8-10,14-15,21H,1-4,11-12H2,5-7H3 |
| InChIKey | RDAZKALCFQAHDG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.40 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|