C23H32N4 — CID 141135466
1-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2H-pyrazolo[1,5-a]pyridine (PubChem CID 141135466) has the molecular formula C23H32N4 and a molecular weight of 364.54 g/mol. Its IUPAC name is 1-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2H-pyrazolo[1,5-a]pyridine.
| Compound Name | 1-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2H-pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 141135466 |
| Molecular Formula | C23H32N4 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | 1-[4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butyl]-2H-pyrazolo[1,5-a]pyridine |
| SMILES | Cc1cccc(N2CCN(CCCCN3CC=C4C=CC=CN43)CC2)c1C |
| InChI | InChI=1S/C23H32N4/c1-20-8-7-10-23(21(20)2)25-18-16-24(17-19-25)12-5-6-13-26-15-11-22-9-3-4-14-27(22)26/h3-4,7-11,14H,5-6,12-13,15-19H2,1-2H3 |
| InChIKey | HQWZOXUBDUDMCK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|