C11H12FNO2 — CID 141142809
6-ethyl-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 141142809) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 6-ethyl-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | 6-ethyl-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 141142809 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 6-ethyl-7-fluoro-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | CCc1c(F)ccc2c1NC(=O)CCO2 |
| InChI | InChI=1S/C11H12FNO2/c1-2-7-8(12)3-4-9-11(7)13-10(14)5-6-15-9/h3-4H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | YREKPTJAMOWIKH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |