sodium 2-fluoro-2-sulfoacetate

C2H2FNaO5S — CID 141149406

IUPACsodium 2-fluoro-2-sulfoacetate
SMILESO=C([O-])C(F)S(=O)(=O)O.[Na+]
InChIInChI=1S/C2H3FO5S.Na/c3-1(2(4)5)9(6,7)8;/h1H,(H,4,5)(H,6,7,8);/q;+1/p-1
InChIKeyOYKHXBCABYZLQH-UHFFFAOYSA-M
MW180.09 g/mol
LogP-5.08
Rot. Bonds2

About sodium 2-fluoro-2-sulfoacetate

sodium 2-fluoro-2-sulfoacetate (PubChem CID 141149406) has the molecular formula C2H2FNaO5S and a molecular weight of 180.09 g/mol. Its IUPAC name is sodium 2-fluoro-2-sulfoacetate.

Molecular Properties

Compound Namesodium 2-fluoro-2-sulfoacetate
PubChem CID141149406
Molecular FormulaC2H2FNaO5S
Molecular Weight180.09 g/mol
Exact Mass179.95
IUPAC Namesodium 2-fluoro-2-sulfoacetate
SMILESO=C([O-])C(F)S(=O)(=O)O.[Na+]
InChIInChI=1S/C2H3FO5S.Na/c3-1(2(4)5)9(6,7)8;/h1H,(H,4,5)(H,6,7,8);/q;+1/p-1
InChIKeyOYKHXBCABYZLQH-UHFFFAOYSA-M
XLogP-5.08
TPSA94.50 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.09
LogP ≤ 5-5.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sodium 2-fluoro-2-sulfoacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-fluoro-2-sulfoacetate?
The IUPAC name of sodium 2-fluoro-2-sulfoacetate (CID 141149406) is sodium 2-fluoro-2-sulfoacetate.
What is the SMILES notation for sodium 2-fluoro-2-sulfoacetate?
The canonical SMILES for sodium 2-fluoro-2-sulfoacetate is O=C([O-])C(F)S(=O)(=O)O.[Na+].
What is the InChIKey of sodium 2-fluoro-2-sulfoacetate?
The InChIKey is OYKHXBCABYZLQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3FO5S.Na/c3-1(2(4)5)9(6,7)8;/h1H,(H,4,5)(H,6,7,8);/q;+1/p-1.
What are the key properties of sodium 2-fluoro-2-sulfoacetate?
sodium 2-fluoro-2-sulfoacetate has a molecular weight of 180.09 g/mol, XLogP of -5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-fluoro-2-sulfoacetate is sourced from PubChem (CID 141149406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).