About sodium 2-fluoro-2-sulfoacetate
sodium 2-fluoro-2-sulfoacetate (PubChem CID 141149406) has the molecular formula C2H2FNaO5S
and a molecular weight of 180.09 g/mol. Its IUPAC name is sodium 2-fluoro-2-sulfoacetate.
Molecular Properties
| Compound Name | sodium 2-fluoro-2-sulfoacetate |
| PubChem CID | 141149406 |
| Molecular Formula | C2H2FNaO5S |
| Molecular Weight | 180.09 g/mol |
| Exact Mass | 179.95 |
| IUPAC Name | sodium 2-fluoro-2-sulfoacetate |
| SMILES | O=C([O-])C(F)S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C2H3FO5S.Na/c3-1(2(4)5)9(6,7)8;/h1H,(H,4,5)(H,6,7,8);/q;+1/p-1 |
| InChIKey | OYKHXBCABYZLQH-UHFFFAOYSA-M |
| XLogP | -5.08 |
| TPSA | 94.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.09 |
| LogP ≤ 5 | -5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-fluoro-2-sulfoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-fluoro-2-sulfoacetate?
The IUPAC name of sodium 2-fluoro-2-sulfoacetate (CID 141149406) is sodium 2-fluoro-2-sulfoacetate.
What is the SMILES notation for sodium 2-fluoro-2-sulfoacetate?
The canonical SMILES for sodium 2-fluoro-2-sulfoacetate is O=C([O-])C(F)S(=O)(=O)O.[Na+].
What is the InChIKey of sodium 2-fluoro-2-sulfoacetate?
The InChIKey is OYKHXBCABYZLQH-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H3FO5S.Na/c3-1(2(4)5)9(6,7)8;/h1H,(H,4,5)(H,6,7,8);/q;+1/p-1.
What are the key properties of sodium 2-fluoro-2-sulfoacetate?
sodium 2-fluoro-2-sulfoacetate has a molecular weight of 180.09 g/mol, XLogP of -5.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-fluoro-2-sulfoacetate is sourced from PubChem (CID 141149406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).