About [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate
[2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate (PubChem CID 141150227) has the molecular formula C25H29O4P
and a molecular weight of 424.48 g/mol. Its IUPAC name is [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate.
Molecular Properties
| Compound Name | [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate |
| PubChem CID | 141150227 |
| Molecular Formula | C25H29O4P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate |
| SMILES | Cc1ccccc1-c1cccc(C(C)C)c1OP(=O)(O)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C25H29O4P/c1-17(2)20-12-8-9-16-24(20)28-30(26,27)29-25-21(18(3)4)14-10-15-23(25)22-13-7-6-11-19(22)5/h6-18H,1-5H3,(H,26,27) |
| InChIKey | YNDPCSPNHQLUGR-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate?
The IUPAC name of [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate (CID 141150227) is [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate.
What is the SMILES notation for [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate?
The canonical SMILES for [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate is Cc1ccccc1-c1cccc(C(C)C)c1OP(=O)(O)Oc1ccccc1C(C)C.
What is the InChIKey of [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate?
The InChIKey is YNDPCSPNHQLUGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29O4P/c1-17(2)20-12-8-9-16-24(20)28-30(26,27)29-25-21(18(3)4)14-10-15-23(25)22-13-7-6-11-19(22)5/h6-18H,1-5H3,(H,26,27).
What are the key properties of [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate?
[2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate has a molecular weight of 424.48 g/mol, XLogP of 7.47, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methylphenyl)-6-propan-2-ylphenyl] (2-propan-2-ylphenyl) hydrogen phosphate is sourced from PubChem (CID 141150227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).