C16H21NO4S — CID 141150419
(8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) ethanesulfonate (PubChem CID 141150419) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is (8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) ethanesulfonate.
| Compound Name | (8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) ethanesulfonate |
|---|---|
| PubChem CID | 141150419 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (8-methoxy-1,2,3,4,4a,10b-hexahydrophenanthridin-2-yl) ethanesulfonate |
| SMILES | CCS(=O)(=O)OC1CCC2N=Cc3cc(OC)ccc3C2C1 |
| InChI | InChI=1S/C16H21NO4S/c1-3-22(18,19)21-13-5-7-16-15(9-13)14-6-4-12(20-2)8-11(14)10-17-16/h4,6,8,10,13,15-16H,3,5,7,9H2,1-2H3 |
| InChIKey | KKRZBBSIFRNRQR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|