C19H16N4OS — CID 141152678
N'-benzyl-N'-phenyl-1H-thieno[3,2-d]pyrazole-5-carbohydrazide (PubChem CID 141152678) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is N'-benzyl-N'-phenyl-1H-thieno[3,2-d]pyrazole-5-carbohydrazide.
| Compound Name | N'-benzyl-N'-phenyl-1H-thieno[3,2-d]pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 141152678 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N'-benzyl-N'-phenyl-1H-thieno[3,2-d]pyrazole-5-carbohydrazide |
| SMILES | O=C(NN(Cc1ccccc1)c1ccccc1)c1cc2cn[nH]c2s1 |
| InChI | InChI=1S/C19H16N4OS/c24-18(17-11-15-12-20-21-19(15)25-17)22-23(16-9-5-2-6-10-16)13-14-7-3-1-4-8-14/h1-12H,13H2,(H,20,21)(H,22,24) |
| InChIKey | ZDLKXSVIFIWACC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|