C6H11NO10S — CID 141165710
(5R,6S,7S,7aR)-7-amino-5-(hydroxymethyl)-2,2-dioxo-5,6-dihydro-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol (PubChem CID 141165710) has the molecular formula C6H11NO10S and a molecular weight of 289.22 g/mol. Its IUPAC name is (5R,6S,7S,7aR)-7-amino-5-(hydroxymethyl)-2,2-dioxo-5,6-dihydro-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol.
| Compound Name | (5R,6S,7S,7aR)-7-amino-5-(hydroxymethyl)-2,2-dioxo-5,6-dihydro-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol |
|---|---|
| PubChem CID | 141165710 |
| Molecular Formula | C6H11NO10S |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | (5R,6S,7S,7aR)-7-amino-5-(hydroxymethyl)-2,2-dioxo-5,6-dihydro-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol |
| SMILES | N[C@]1(O)[C@@H](O)[C@@H](CO)OC2(O)OS(=O)(=O)O[C@@]21O |
| InChI | InChI=1S/C6H11NO10S/c7-4(10)3(9)2(1-8)15-6(12)5(4,11)16-18(13,14)17-6/h2-3,8-12H,1,7H2/t2-,3+,4+,5-,6?/m1/s1 |
| InChIKey | FZSVDWICDYHUFN-SVZMEOIVSA-N |
| XLogP | -4.99 |
| TPSA | 189.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|