C6H10O9S — CID 140556041
(5S,6R,7R,7aR)-5-methyl-2,2-dioxo-6,7-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol (PubChem CID 140556041) has the molecular formula C6H10O9S and a molecular weight of 258.20 g/mol. Its IUPAC name is (5S,6R,7R,7aR)-5-methyl-2,2-dioxo-6,7-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol.
| Compound Name | (5S,6R,7R,7aR)-5-methyl-2,2-dioxo-6,7-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol |
|---|---|
| PubChem CID | 140556041 |
| Molecular Formula | C6H10O9S |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | (5S,6R,7R,7aR)-5-methyl-2,2-dioxo-6,7-dihydro-5H-[1,3,2]dioxathiolo[4,5-b]pyran-3a,6,7,7a-tetrol |
| SMILES | C[C@@H]1OC2(O)OS(=O)(=O)O[C@]2(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C6H10O9S/c1-2-3(7)4(8)5(9)6(10,13-2)15-16(11,12)14-5/h2-4,7-10H,1H3/t2-,3-,4+,5+,6?/m0/s1 |
| InChIKey | VTTOVKOMHDZPJH-JFNONXLTSA-N |
| XLogP | -3.25 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |