C22H24O2 — CID 141171642
3,6-ditert-butylphenanthrene-1,2-dione (PubChem CID 141171642) has the molecular formula C22H24O2 and a molecular weight of 320.43 g/mol. Its IUPAC name is 3,6-ditert-butylphenanthrene-1,2-dione.
| Compound Name | 3,6-ditert-butylphenanthrene-1,2-dione |
|---|---|
| PubChem CID | 141171642 |
| Molecular Formula | C22H24O2 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3,6-ditert-butylphenanthrene-1,2-dione |
| SMILES | CC(C)(C)C1=Cc2c(ccc3ccc(C(C)(C)C)cc23)C(=O)C1=O |
| InChI | InChI=1S/C22H24O2/c1-21(2,3)14-9-7-13-8-10-15-17(16(13)11-14)12-18(22(4,5)6)20(24)19(15)23/h7-12H,1-6H3 |
| InChIKey | MOZSFZTXBWIZFJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|