About (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate
(4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate (PubChem CID 141187337) has the molecular formula C20H26NO8P
and a molecular weight of 439.40 g/mol. Its IUPAC name is (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate.
Molecular Properties
| Compound Name | (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate |
| PubChem CID | 141187337 |
| Molecular Formula | C20H26NO8P |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(OCC2CCC3OC3C2)OCC2CCC3OC3C2)cc1 |
| InChI | InChI=1S/C20H26NO8P/c22-21(23)15-3-5-16(6-4-15)29-30(24,25-11-13-1-7-17-19(9-13)27-17)26-12-14-2-8-18-20(10-14)28-18/h3-6,13-14,17-20H,1-2,7-12H2 |
| InChIKey | UHOXKHMIBYCHRN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate?
The IUPAC name of (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate (CID 141187337) is (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate.
What is the SMILES notation for (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate?
The canonical SMILES for (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate is O=[N+]([O-])c1ccc(OP(=O)(OCC2CCC3OC3C2)OCC2CCC3OC3C2)cc1.
What is the InChIKey of (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate?
The InChIKey is UHOXKHMIBYCHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26NO8P/c22-21(23)15-3-5-16(6-4-15)29-30(24,25-11-13-1-7-17-19(9-13)27-17)26-12-14-2-8-18-20(10-14)28-18/h3-6,13-14,17-20H,1-2,7-12H2.
What are the key properties of (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate?
(4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate has a molecular weight of 439.40 g/mol, XLogP of 4.25, 9 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) bis(7-oxabicyclo[4.1.0]heptan-3-ylmethyl) phosphate is sourced from PubChem (CID 141187337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).