About 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine
2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine (PubChem CID 141192036) has the molecular formula C14H8ClF6N5
and a molecular weight of 395.69 g/mol. Its IUPAC name is 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine.
Molecular Properties
| Compound Name | 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine |
| PubChem CID | 141192036 |
| Molecular Formula | C14H8ClF6N5 |
| Molecular Weight | 395.69 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)n(Cc2ccn(-c3ncccc3Cl)n2)n1 |
| InChI | InChI=1S/C14H8ClF6N5/c15-9-2-1-4-22-12(9)25-5-3-8(23-25)7-26-11(14(19,20)21)6-10(24-26)13(16,17)18/h1-6H,7H2 |
| InChIKey | JNVJUKJLAUBQNN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.69 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine?
The IUPAC name of 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine (CID 141192036) is 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine.
What is the SMILES notation for 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine?
The canonical SMILES for 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine is FC(F)(F)c1cc(C(F)(F)F)n(Cc2ccn(-c3ncccc3Cl)n2)n1.
What is the InChIKey of 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine?
The InChIKey is JNVJUKJLAUBQNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8ClF6N5/c15-9-2-1-4-22-12(9)25-5-3-8(23-25)7-26-11(14(19,20)21)6-10(24-26)13(16,17)18/h1-6H,7H2.
What are the key properties of 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine?
2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine has a molecular weight of 395.69 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]pyrazol-1-yl]-3-chloropyridine is sourced from PubChem (CID 141192036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).