C15H8ClF6N5O2 — CID 91528453
[3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-1-(3-chloro-2-pyridinyl)pyrazol-5-yl] formate (PubChem CID 91528453) has the molecular formula C15H8ClF6N5O2 and a molecular weight of 439.70 g/mol. Its IUPAC name is [3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-1-(3-chloro-2-pyridinyl)pyrazol-5-yl] formate.
| Compound Name | [3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-1-(3-chloro-2-pyridinyl)pyrazol-5-yl] formate |
|---|---|
| PubChem CID | 91528453 |
| Molecular Formula | C15H8ClF6N5O2 |
| Molecular Weight | 439.70 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | [3-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-1-(3-chloro-2-pyridinyl)pyrazol-5-yl] formate |
| SMILES | O=COc1cc(Cn2nc(C(F)(F)F)cc2C(F)(F)F)nn1-c1ncccc1Cl |
| InChI | InChI=1S/C15H8ClF6N5O2/c16-9-2-1-3-23-13(9)27-12(29-7-28)4-8(24-27)6-26-11(15(20,21)22)5-10(25-26)14(17,18)19/h1-5,7H,6H2 |
| InChIKey | GBTYUQLQXGKBHL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|