C23H34 — CID 141196487
4-ethenyl-6-methyl-7,7-bis(prop-1-enyl)-5-prop-1-en-2-ylundeca-1,5,8-triene (PubChem CID 141196487) has the molecular formula C23H34 and a molecular weight of 310.53 g/mol. Its IUPAC name is 4-ethenyl-6-methyl-7,7-bis(prop-1-enyl)-5-prop-1-en-2-ylundeca-1,5,8-triene.
| Compound Name | 4-ethenyl-6-methyl-7,7-bis(prop-1-enyl)-5-prop-1-en-2-ylundeca-1,5,8-triene |
|---|---|
| PubChem CID | 141196487 |
| Molecular Formula | C23H34 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | 4-ethenyl-6-methyl-7,7-bis(prop-1-enyl)-5-prop-1-en-2-ylundeca-1,5,8-triene |
| SMILES | C=CCC(C=C)C(C(=C)C)=C(C)C(C=CC)(C=CC)C=CCC |
| InChI | InChI=1S/C23H34/c1-9-14-18-23(16-11-3,17-12-4)20(8)22(19(6)7)21(13-5)15-10-2/h10-14,16-18,21H,2,5-6,9,15H2,1,3-4,7-8H3 |
| InChIKey | ZSLCPUPEHZSXKF-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|