C19H28 — CID 141300507
6-ethenyl-4-methyl-5,6-bis(prop-1-enyl)deca-2,4,7-triene (PubChem CID 141300507) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is 6-ethenyl-4-methyl-5,6-bis(prop-1-enyl)deca-2,4,7-triene.
| Compound Name | 6-ethenyl-4-methyl-5,6-bis(prop-1-enyl)deca-2,4,7-triene |
|---|---|
| PubChem CID | 141300507 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | 6-ethenyl-4-methyl-5,6-bis(prop-1-enyl)deca-2,4,7-triene |
| SMILES | C=CC(C=CC)(C=CCC)C(C=CC)=C(C)C=CC |
| InChI | InChI=1S/C19H28/c1-7-12-16-19(11-5,15-10-4)18(14-9-3)17(6)13-8-2/h8-16H,5,7H2,1-4,6H3 |
| InChIKey | KYKSFNBPVURKFZ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|