C19H22F4NPS — CID 141196809
(2R)-5-[2-fluoro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methyl-1-phosphanylpentan-2-amine (PubChem CID 141196809) has the molecular formula C19H22F4NPS and a molecular weight of 403.43 g/mol. Its IUPAC name is (2R)-5-[2-fluoro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methyl-1-phosphanylpentan-2-amine.
| Compound Name | (2R)-5-[2-fluoro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methyl-1-phosphanylpentan-2-amine |
|---|---|
| PubChem CID | 141196809 |
| Molecular Formula | C19H22F4NPS |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | (2R)-5-[2-fluoro-4-[3-(trifluoromethyl)phenyl]sulfanylphenyl]-2-methyl-1-phosphanylpentan-2-amine |
| SMILES | C[C@](N)(CP)CCCc1ccc(Sc2cccc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C19H22F4NPS/c1-18(24,12-25)9-3-4-13-7-8-16(11-17(13)20)26-15-6-2-5-14(10-15)19(21,22)23/h2,5-8,10-11H,3-4,9,12,24-25H2,1H3/t18-/m1/s1 |
| InChIKey | HHGXBZFJLSWKHR-GOSISDBHSA-N |
| XLogP | 5.91 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|