About 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole
2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole (PubChem CID 141198701) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole |
| PubChem CID | 141198701 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole |
| SMILES | c1ccc(CCc2cc3[nH]ccc3s2)cc1 |
| InChI | InChI=1S/C14H13NS/c1-2-4-11(5-3-1)6-7-12-10-13-14(16-12)8-9-15-13/h1-5,8-10,15H,6-7H2 |
| InChIKey | GBMYXBACWQPGBR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole?
The IUPAC name of 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole (CID 141198701) is 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole.
What is the SMILES notation for 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole?
The canonical SMILES for 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole is c1ccc(CCc2cc3[nH]ccc3s2)cc1.
What is the InChIKey of 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole?
The InChIKey is GBMYXBACWQPGBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c1-2-4-11(5-3-1)6-7-12-10-13-14(16-12)8-9-15-13/h1-5,8-10,15H,6-7H2.
What are the key properties of 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole?
2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole has a molecular weight of 227.33 g/mol, XLogP of 4.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)-4H-thieno[3,2-b]pyrrole is sourced from PubChem (CID 141198701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).