C19H28O2 — CID 141201650
2,4-dimethyl-2-(5,5,8,8-tetramethyl-1,6,7,8a-tetrahydronaphthalen-2-yl)-1,3-dioxole (PubChem CID 141201650) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2,4-dimethyl-2-(5,5,8,8-tetramethyl-1,6,7,8a-tetrahydronaphthalen-2-yl)-1,3-dioxole.
| Compound Name | 2,4-dimethyl-2-(5,5,8,8-tetramethyl-1,6,7,8a-tetrahydronaphthalen-2-yl)-1,3-dioxole |
|---|---|
| PubChem CID | 141201650 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2,4-dimethyl-2-(5,5,8,8-tetramethyl-1,6,7,8a-tetrahydronaphthalen-2-yl)-1,3-dioxole |
| SMILES | CC1=COC(C)(C2=CC=C3C(C2)C(C)(C)CCC3(C)C)O1 |
| InChI | InChI=1S/C19H28O2/c1-13-12-20-19(6,21-13)14-7-8-15-16(11-14)18(4,5)10-9-17(15,2)3/h7-8,12,16H,9-11H2,1-6H3 |
| InChIKey | QVBPKSDTTKAFBN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |