C17H34O5Si4 — CID 141208263
3-[tris[[ethenyl(dimethyl)silyl]oxy]silylmethoxy]but-3-en-2-one (PubChem CID 141208263) has the molecular formula C17H34O5Si4 and a molecular weight of 430.80 g/mol. Its IUPAC name is 3-[tris[[ethenyl(dimethyl)silyl]oxy]silylmethoxy]but-3-en-2-one.
| Compound Name | 3-[tris[[ethenyl(dimethyl)silyl]oxy]silylmethoxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141208263 |
| Molecular Formula | C17H34O5Si4 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 3-[tris[[ethenyl(dimethyl)silyl]oxy]silylmethoxy]but-3-en-2-one |
| SMILES | C=C[Si](C)(C)O[Si](COC(=C)C(C)=O)(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C17H34O5Si4/c1-12-23(6,7)20-26(21-24(8,9)13-2,22-25(10,11)14-3)15-19-17(5)16(4)18/h12-14H,1-3,5,15H2,4,6-11H3 |
| InChIKey | PRTNYSPYIQVUFR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|