C16H12N2O4 — CID 141225689
2-amino-6-[2-(3-amino-5-carboxyphenyl)ethynyl]benzoic acid (PubChem CID 141225689) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 2-amino-6-[2-(3-amino-5-carboxyphenyl)ethynyl]benzoic acid.
| Compound Name | 2-amino-6-[2-(3-amino-5-carboxyphenyl)ethynyl]benzoic acid |
|---|---|
| PubChem CID | 141225689 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-amino-6-[2-(3-amino-5-carboxyphenyl)ethynyl]benzoic acid |
| SMILES | Nc1cc(C#Cc2cccc(N)c2C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H12N2O4/c17-12-7-9(6-11(8-12)15(19)20)4-5-10-2-1-3-13(18)14(10)16(21)22/h1-3,6-8H,17-18H2,(H,19,20)(H,21,22) |
| InChIKey | DCKVVTBAQWUHDR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|